| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 3-[3-(4-Bromophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid Basic information |
| | 3-[3-(4-Bromophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid Chemical Properties |
| form | solid | | InChI | 1S/C11H9BrN2O3/c12-8-3-1-7(2-4-8)11-13-9(17-14-11)5-6-10(15)16/h1-4H,5-6H2,(H,15,16) | | InChIKey | LBFLFJKKZLTGOV-UHFFFAOYSA-N | | SMILES | O=C(O)CCC1=NC(C(C=C2)=CC=C2Br)=NO1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-[3-(4-Bromophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid Usage And Synthesis |
| | 3-[3-(4-Bromophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid Preparation Products And Raw materials |
|