|
|
| | 1,3-Butanediol dimethacrylate Basic information |
| | 1,3-Butanediol dimethacrylate Chemical Properties |
| Boiling point | 290 °C (lit.) | | density | 1.01 g/mL at 25 °C (lit.) | | vapor pressure | 1.1hPa at 20℃ | | refractive index | n20/D 1.456(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Insoluble in water | | form | clear liquid | | color | Colorless | | Water Solubility | 243mg/L at 20℃ | | InChI | InChI=1S/C12H18O4/c1-8(2)11(13)15-7-6-10(5)16-12(14)9(3)4/h10H,1,3,6-7H2,2,4-5H3 | | InChIKey | VDYWHVQKENANGY-UHFFFAOYSA-N | | SMILES | C(OC(=O)C(C)=C)(C)CCOC(=O)C(C)=C | | LogP | 3.1 at 20℃ | | CAS DataBase Reference | 1189-08-8(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3-Butanediol, bis(2-methylpropenoate)(1189-08-8) | | EPA Substance Registry System | 1,3 Butanediol dimethacrylate (1189-08-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36/37/39-28 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 2916.14.2050 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3-Butanediol dimethacrylate Usage And Synthesis |
| Uses | 1,3-Butanediol Dimethacrylate is used in method for preparing low odor two component structural adhesive compd. cured by acrylate and epoxy system. | | Definition | ChEBI: 1,3-Butyleneglycol dimethacrylate is a dicarboxylic acid. |
| | 1,3-Butanediol dimethacrylate Preparation Products And Raw materials |
|