| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:Azure B tetrafluoroborate CAS:79288-94-1 Package:1g,25g,5g
|
|
| | AZURE B TETRAFLUOROBORATE Basic information |
| Product Name: | AZURE B TETRAFLUOROBORATE | | Synonyms: | N-(4-ETHYLBENZENE)-4-METHOXYBENZENE-2,6-DIPHENYLPYRIDINIUM TETRAFLUOROBORATE;3-(dimethylamino)-7-(methylamino)phenothiazin-5-ium tetrafluoroborate;AZURE I BIOGICAL STAIN;Phenothiazin-5-ium, 3-(dimethylamino)-7-(methylamino)-, tetrafluoroborate(1-);AZURE B TETRAFLUOROBORATE;AZUR B TETRAFLUOROBORATE;Einecs 279-128-6;n-Methyl-n-(7-(methylamino)-3h-phenothiazin-3-ylidene)methanaminium tetrafluoroborate | | CAS: | 79288-94-1 | | MF: | C15H16BF4N3S | | MW: | 357.18 | | EINECS: | 279-128-6 | | Product Categories: | Miscellaneous;A;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 79288-94-1.mol |  |
| | AZURE B TETRAFLUOROBORATE Chemical Properties |
| Melting point | 244°C (dec.) | | storage temp. | room temp | | form | powder | | λmax | 637 nm | | ε(extinction coefficient) | ≥15000 at 241-247nm in methanol at 0.003g/L ≥44000 at 286-292nm in methanol at 0.003g/L | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C15H15N3S.BF4/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;2-1(3,4)5/h4-9H,1-3H3;/q;-1/p+1 | | InChIKey | OYVZJZSEBPXXFF-UHFFFAOYSA-O | | SMILES | F[B-](F)(F)F.CNc1ccc2N=C3C=C\C(C=C3Sc2c1)=[N+](/C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | AZURE B TETRAFLUOROBORATE Usage And Synthesis |
| Uses | diagnostic assay manufacturing hematology histology |
| | AZURE B TETRAFLUOROBORATE Preparation Products And Raw materials |
|