|
|
| | 2-CHLORO-4-FLUOROBENZYL ALCOHOL Basic information |
| | 2-CHLORO-4-FLUOROBENZYL ALCOHOL Chemical Properties |
| Melting point | 45-48 °C(lit.) | | Boiling point | 160°C (rough estimate) | | density | 1.2780 (estimate) | | Fp | 230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 13.54±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C7H6ClFO/c8-7-3-6(9)2-1-5(7)4-10/h1-3,10H,4H2 | | InChIKey | ZUHMDLLAHZUDRE-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(F)C=C1Cl | | CAS DataBase Reference | 208186-84-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29062990 |
| | 2-CHLORO-4-FLUOROBENZYL ALCOHOL Usage And Synthesis |
| Chemical Properties | WHITE CRYSTALLINE POWDER |
| | 2-CHLORO-4-FLUOROBENZYL ALCOHOL Preparation Products And Raw materials |
|