Propyl chloroacetate manufacturers
- Propyl chloroacetate
-
-
2026-06-30
- CAS:5396-24-7
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | Propyl chloroacetate Basic information |
| Product Name: | Propyl chloroacetate | | Synonyms: | CHLOROACETIC ACID PROPYL ESTER;PROPYL CHLOROACETATE;Acetic acid, chloro-, propyl ester;4-BRORNO-2'',4''-DICHLOROCHALCONE;2-chloroacetic acid propyl ester;propyl 2-chloroethanoate;2-oxaspiro[2.5]octane-4,5,6,7,8-pentol;propyl 2-chloroacetate | | CAS: | 5396-24-7 | | MF: | C5H9ClO2 | | MW: | 136.58 | | EINECS: | 226-411-7 | | Product Categories: | | | Mol File: | 5396-24-7.mol |  |
| | Propyl chloroacetate Chemical Properties |
| Boiling point | 181.12°C (rough estimate) | | density | 1.1040 | | refractive index | 1.4261 | | InChI | InChI=1S/C5H9ClO2/c1-2-3-8-5(7)4-6/h2-4H2,1H3 | | InChIKey | QJZNRCWAXUGABH-UHFFFAOYSA-N | | SMILES | C(OCCC)(=O)CCl | | NIST Chemistry Reference | Chloroacetic acid propyl ester(5396-24-7) |
| | Propyl chloroacetate Usage And Synthesis |
| | Propyl chloroacetate Preparation Products And Raw materials |
|