Propyl chloroacetate manufacturers
- Propyl chloroacetate
-
- $0.00 / 25KG
-
2025-07-25
- CAS:5396-24-7
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| Propyl chloroacetate Basic information |
Product Name: | Propyl chloroacetate | Synonyms: | CHLOROACETIC ACID PROPYL ESTER;PROPYL CHLOROACETATE;Acetic acid, chloro-, propyl ester;4-BRORNO-2'',4''-DICHLOROCHALCONE;2-chloroacetic acid propyl ester;propyl 2-chloroacetate;propyl 2-chloroethanoate;2-oxaspiro[2.5]octane-4,5,6,7,8-pentol | CAS: | 5396-24-7 | MF: | C5H9ClO2 | MW: | 136.58 | EINECS: | 226-411-7 | Product Categories: | | Mol File: | 5396-24-7.mol |  |
| Propyl chloroacetate Chemical Properties |
Boiling point | 181.12°C (rough estimate) | density | 1.1040 | refractive index | 1.4261 | InChI | InChI=1S/C5H9ClO2/c1-2-3-8-5(7)4-6/h2-4H2,1H3 | InChIKey | QJZNRCWAXUGABH-UHFFFAOYSA-N | SMILES | C(OCCC)(=O)CCl | NIST Chemistry Reference | Chloroacetic acid propyl ester(5396-24-7) |
| Propyl chloroacetate Usage And Synthesis |
| Propyl chloroacetate Preparation Products And Raw materials |
|