|
|
| | 2,6-DICHLORO-4-(TRIFLUOROMETHOXY)ANILINE Basic information |
| Product Name: | 2,6-DICHLORO-4-(TRIFLUOROMETHOXY)ANILINE | | Synonyms: | 2,6-DICHLORO-4-(TRIFLUOROMETHOXY)ANILINE;2,6-DICHLORO-4-TRIFLUOROMETHOXY-PHENYLAMINE;3,5-DICHLORO-4-AMINOTRIFLUOROMETHOXY BENZENE;TIMTEC-BB SBB003181;3,5-Dichloro-4-Aminotrifluoromethoxy;2,6-Dichloro-4-(trifluoromethoxy)aniline, 98+%;2,6-Dichloro-4-(trifluoromethoxy)aniline 98%;2-Amino-1,3-Dichloro-5-(Trifluoromethoxy)Benzene | | CAS: | 99479-66-0 | | MF: | C7H4Cl2F3NO | | MW: | 246.01 | | EINECS: | | | Product Categories: | Amines;C7;Nitrogen Compounds | | Mol File: | 99479-66-0.mol |  |
| | 2,6-DICHLORO-4-(TRIFLUOROMETHOXY)ANILINE Chemical Properties |
| Melting point | 30-32 °C (lit.) | | Boiling point | 60-62°C | | density | 1.576±0.06 g/cm3(Predicted) | | Fp | >230 °F | | refractive index | 1.4981 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | -0.15±0.10(Predicted) | | form | Powder, Low Melting Solid or Crystalline Needles | | color | Colorless to white to pale brown | | InChI | 1S/C7H4Cl2F3NO/c8-4-1-3(14-7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 | | InChIKey | FKISQWQHZULEEG-UHFFFAOYSA-N | | SMILES | Nc1c(Cl)cc(OC(F)(F)F)cc1Cl | | CAS DataBase Reference | 99479-66-0(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | TOXIC | | HS Code | 2922290090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,6-DICHLORO-4-(TRIFLUOROMETHOXY)ANILINE Usage And Synthesis |
| Uses | 2,6-Dichloro-4-(trifluoromethoxy)aniline is a nitrogen compound useful in organic synthesis. | | General Description | 2,6-Dichloro-4-(trifluoromethoxy)aniline is a nitrogen compound useful in organic synthesis. |
| | 2,6-DICHLORO-4-(TRIFLUOROMETHOXY)ANILINE Preparation Products And Raw materials |
|