3-FUCOSYLLACTOSE manufacturers
- 3-Fucosyllactose
-
- $496.00 / 50mg
-
2026-04-29
- CAS:41312-47-4
- Min. Order:
- Purity: 99.99%
- Supply Ability: 10g
- 3-Fucosyllactose
-
- $0.00 / 25KG
-
2025-12-01
- CAS:41312-47-4
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | 3-FUCOSYLLACTOSE Basic information |
| Product Name: | 3-FUCOSYLLACTOSE | | Synonyms: | 3-FUCOSYLLACTOSE;(2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-oxan-4-yl]oxy-6-methyl-oxane-3,4,5-triol;3-Fucosyllactose (3FL);3-FL;α-L-Fuc-(1→3)-[β-D-Gal-(1→4)]-D-Glc;(2S,3S,4R,5S,6S)-2-[(3R,4R,5R,6R)-2,3-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol;3-FL, α-L-Fuc-(1-3)-[β-D-Gal-(1-4)]-D-Glc;D-Glucose, O-6-deoxy-α-L-galactopyranosyl-(1→3)-O-[β-D-galactopyranosyl-(1→4)]- | | CAS: | 41312-47-4 | | MF: | C18H32O15 | | MW: | 488.44 | | EINECS: | | | Product Categories: | Carbohydrates;Carbohydrates A to;Carbohydrates D-FBiochemicals and Reagents;Oligosaccharide | | Mol File: | 41312-47-4.mol |  |
| | 3-FUCOSYLLACTOSE Chemical Properties |
| Melting point | >165°C (dec.) | | Boiling point | 916.5±65.0 °C(Predicted) | | density | 1.68±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Water (Slightly) | | pka | 12.20±0.20(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | AUNPEJDACLEKSC-BNBWMEOCNA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@H]([C@H]1CO)O)O)O)O[C@@H]2[C@H](OC([C@@H]([C@H]2O[C@@H]3O[C@H]([C@H]([C@H]([C@@H]3O)O)O)C)O)O)CO |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 3-FUCOSYLLACTOSE Usage And Synthesis |
| Uses | glucose analogue of Lewisx | | Definition | ChEBI: 3-fucosyllactose is a trisaccharide that is lactose in which the hydroxy group at position 3 of the glucosyl moiety has undergone formal condensation with the anomeric hydroxy group of fucose (6-deoxy-L-galactose) to give the corresponding glycoside. Found in human milk. It has a role as a human metabolite. It is functionally related to a lactose. |
| | 3-FUCOSYLLACTOSE Preparation Products And Raw materials |
|