|
|
| | 2-AMINO-1-MORPHOLIN-4-YL-ETHANONE HCL Basic information |
| Product Name: | 2-AMINO-1-MORPHOLIN-4-YL-ETHANONE HCL | | Synonyms: | 2-Amino-1-morpholinoethanone hydrochloride;4-Glycylmorpholine hydrochloride;2-Amino-1-(4-morpholinyl)ethanone hydrochloride 98%;2-AMINO-1-MORPHOLIN-4-YL-ETHANONE HCL;2-AMINO-1-MORPHOLIN-4-YL-ETHANONE HYDROCHLORIDE;2-AMINO-1-MORPHOLINO-1-ETHANONE HYDROCHLORIDE;2-Amino-1-morpholin-4-yl-1-ethanone hydrochloride;2-Amino-1-morpholin-4-yl-ethanonexHCl | | CAS: | 24152-96-3 | | MF: | C6H13ClN2O2 | | MW: | 180.63 | | EINECS: | | | Product Categories: | | | Mol File: | 24152-96-3.mol |  |
| | 2-AMINO-1-MORPHOLIN-4-YL-ETHANONE HCL Chemical Properties |
| Melting point | 245-246°C | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | crystals | | color | Colourless | | BRN | 3702996 | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H12N2O2.ClH/c7-5-6(9)8-1-3-10-4-2-8;/h1-5,7H2;1H | | InChIKey | XNMVLMPXYUXCBV-UHFFFAOYSA-N | | SMILES | N1(CCOCC1)C(CN)=O.Cl |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 |
| | 2-AMINO-1-MORPHOLIN-4-YL-ETHANONE HCL Usage And Synthesis |
| | 2-AMINO-1-MORPHOLIN-4-YL-ETHANONE HCL Preparation Products And Raw materials |
|