- 2-Chloro-4-fluoropyridine
-
- $200.00 / 1KG
-
2025-09-25
- CAS:34941-91-8
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
- 2-Chloro-4-fluoropyridine
-
- $2.00 / 1KG
-
2020-01-08
- CAS:34941-91-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100g , 1kg, 5kg , 50kg
|
| | 2-Chloro-4-fluoropyridine Basic information |
| | 2-Chloro-4-fluoropyridine Chemical Properties |
| Boiling point | 140°C | | density | 1,456g/cm | | Fp | 140°C | | refractive index | 1.5015 | | storage temp. | Inert atmosphere,2-8°C | | pka | 1.20±0.10(Predicted) | | form | Liquid | | color | Colorless to pale yellow | | BRN | 1634747 | | InChI | InChI=1S/C5H3ClFN/c6-5-3-4(7)1-2-8-5/h1-3H | | InChIKey | FGSAQRJRWCZLOB-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC(F)=C1 | | CAS DataBase Reference | 34941-91-8(CAS DataBase Reference) |
| Hazard Codes | Xi,F,Xn | | Risk Statements | 20/21/22-36/37/38-10 | | Safety Statements | 26-36/37/39-36 | | RIDADR | 1993 | | WGK Germany | WGK 3 | | Hazard Note | Flammable/Irritant | | HazardClass | TOXIC, FLAMMABLE | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 2-Chloro-4-fluoropyridine Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 2-Chloro-4-fluoropyridine is a useful research chemical. |
| | 2-Chloro-4-fluoropyridine Preparation Products And Raw materials |
|