DUROQUINONE manufacturers
- DUROQUINONE
-
- $8.80 / 1kg
-
2026-04-17
- CAS:527-17-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- Duroquinone
-
- $0.00 / 1kg
-
2025-04-04
- CAS:527-17-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
|
| | DUROQUINONE Basic information |
| Product Name: | DUROQUINONE | | Synonyms: | 2,3,5,6-Tetramethylbenzo-1,4-quinone;2,3,5,6-Tetramethylbenzoquinone;2,3,5,6-tetramethyl-p-benzoquinon;2,3,5,6-Tetramethyl-p-benzoquinone;2,5-Cyclohexadiene-1,4-dione, 2,3,5,6-tetramethyl-;4-dione,2,3,5,6-tetramethyl-5-cyclohexadiene-1;p-Benzoquinone, tetramethyl-;tetramethyl-p-benzoquinon | | CAS: | 527-17-3 | | MF: | C10H12O2 | | MW: | 164.2 | | EINECS: | 208-409-8 | | Product Categories: | Anthraquinones, Hydroquinones and Quinones;Benzoquinones | | Mol File: | 527-17-3.mol |  |
| | DUROQUINONE Chemical Properties |
| Melting point | 110-112 °C(lit.) | | Boiling point | 251.67°C (rough estimate) | | density | 1.0326 (rough estimate) | | refractive index | 1.5220 (estimate) | | storage temp. | under inert gas (Argon) | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | Merck | 14,3470 | | BRN | 1909128 | | InChI | InChI=1S/C10H12O2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h1-4H3 | | InChIKey | WAMKWBHYPYBEJY-UHFFFAOYSA-N | | SMILES | C1(=O)C(C)=C(C)C(=O)C(C)=C1C | | CAS DataBase Reference | 527-17-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | GU5410000 | | HS Code | 29146990 | | Storage Class | 11 - Combustible Solids |
| | DUROQUINONE Usage And Synthesis |
| Chemical Properties | YELLOW POWDER | | Uses | Tetramethyl-1,4-benzoquinone is an antioxidant. | | Definition | ChEBI: Duroquinone is a member of the class of 1,4-benzoquinones that is 1,4-benzoquinone in which all four hydrogens are substituted by methyl groups. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 34, p. 1216, 1969 DOI: 10.1021/jo01257a007 | | Purification Methods | Crystallise duraquinone from 95% EtOH. Dry it in vacuo.[Beilstein 7 H 669, 7 III 3417, 7 IV 2101.] |
| | DUROQUINONE Preparation Products And Raw materials |
|