|
|
| | tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate Basic information | | Uses |
| Product Name: | tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate | | Synonyms: | TERT-BUTYL 3,9-DIAZASPIRO[5.5]UNDECANE-3-CARBOXYLATE;3,9-DIAZASPIRO[5.5]UNDECANE-3-CARBOXYLIC ACID T-BUTYL ESTER;3,9-DIAZA-SPIRO[5.5]UNDECANE-3-CARBOXYLIC ACID TERT-BUTYL ESTER;Tert-Butyl3,9-Diazaspiro[5.5]Undecane-3-Carboxyla;3,9-Diazaspiro[5.5]undecane-3-carboxylic acid, 1,1-dimethylethyl ester;3-Boc-3,9-Diazaspiro[5.5]undecane;3-N-Boc-3,9-diazaspiro[5.5]undecane;3-Boc-3,9-diazaspiro[5.5]... | | CAS: | 173405-78-2 | | MF: | C14H26N2O2 | | MW: | 254.37 | | EINECS: | | | Product Categories: | Heterocycles series;pharmacetical | | Mol File: | 173405-78-2.mol | ![tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate Structure](CAS/GIF/173405-78-2.gif) |
| | tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate Chemical Properties |
| Melting point | 0°C | | Boiling point | 0°C | | density | 1.05 | | Fp | 0°C | | storage temp. | 2-8°C(protect from light) | | pka | 11.00±0.20(Predicted) | | form | solid | | color | White | | InChI | InChI=1S/C14H26N2O2/c1-13(2,3)18-12(17)16-10-6-14(7-11-16)4-8-15-9-5-14/h15H,4-11H2,1-3H3 | | InChIKey | YLKHACHFJMCIRE-UHFFFAOYSA-N | | SMILES | C1C2(CCNCC2)CCN(C(OC(C)(C)C)=O)C1 |
| | tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate Usage And Synthesis |
| Uses | 3,9-diazaspiro[5.5]undecane-3-carboxylic acid tert-butyl ester has shown wide application value in many fields. In the pharmaceutical field, it can be used as a raw material for synthesizing drug molecules with specific biological activities. | | Synthesis |
Under argon atmosphere, wet Pd/C (188.05 mg, 159.50 μmol, purity 10%) was added into tert-butyl 9-benzyl-3,9-diazaspiro[5.5]undecane-3-carboxylate in THF solution (1.10 g, 3.19 mmol), after replacing the gas in the flask 3 times with hydrogen, the reaction was stirred at 40°C for 40 hours under 45 Psi. After completion of the reaction, the solution was filtered through diatomite. The filtrate was concentrated to give the crude tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate.
|
| | tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate Preparation Products And Raw materials |
|