|
|
| | 1,5-Pentanediol diacrylate Basic information |
| Product Name: | 1,5-Pentanediol diacrylate | | Synonyms: | 1,5-pentanediyl diacrylate;1,5-PENTANEDIOL DIACRYLATE;1,5-PENTAMETHYLENE GLYCOL DIACRYLATE;Bisacrylic acid pentane-1,5-diyl ester;Bispropenoic acid 1,5-pentanediyl;Einecs 253-235-8;1,5-Pentanediol diacrylate homopolymer;N′,N′-(4,10-dioxa-3,11-dioxo-tridecanylene)-1,13-bis(1,2,3,4-tetrahydroisoquinoline)-bioxalate AND 1,5-Pentamethylene Diacrylate | | CAS: | 36840-85-4 | | MF: | C11H16O4 | | MW: | 212.24 | | EINECS: | 253-235-8 | | Product Categories: | monomer | | Mol File: | 36840-85-4.mol |  |
| | 1,5-Pentanediol diacrylate Chemical Properties |
| Boiling point | 90-95 °C(Press: 0.1 Torr) | | density | 1.024±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Soluble) | | form | liquid | | color | Yellow | | InChI | InChI=1S/C11H16O4/c1-3-10(12)14-8-6-5-7-9-15-11(13)4-2/h3-4H,1-2,5-9H2 | | InChIKey | XAMCLRBWHRRBCN-UHFFFAOYSA-N | | SMILES | C(OC(=O)C=C)CCCCOC(=O)C=C |
| | 1,5-Pentanediol diacrylate Usage And Synthesis |
| Chemical Properties | Colorless to pale yellow liquid | | Uses | 1,5-Pentanediol Diacrylate (Stabilized with Hydroquinone) is used in reparation method of PUV cured polythiol resin and cured film. | | Synthesis | a) 1,5-Pentanediol (15.6 g) was heated at reflux with 3-bromopropionic acid (50.5 g) and trace amounts of p-toluenesulfonic acid in toluene (500 mL) for 4 hours. After completion of the reaction, the toluene solution was cooled and washed with aqueous sodium acetate. Subsequently, triethylamine (50 mL) was added under reflux conditions. After cooling the reaction mixture, it was washed well with water to remove triethylamine and triethylamine hydrobromide. Toluene was removed by distillation under reduced pressure and finally purified by high-vacuum distillation (boiling point 90°C-95°C/0.1 mmHg) to afford 1,5-pentanediol diacrylate (24.0 g, 75% yield) as a light-colored liquid. | | References | [1] Patent: US5453510, 1995, A |
| | 1,5-Pentanediol diacrylate Preparation Products And Raw materials |
|