|
|
| | 2-Bromo-6-fluorobenzoic acid Basic information |
| | 2-Bromo-6-fluorobenzoic acid Chemical Properties |
| Melting point | 153-155°C | | Boiling point | 286.1±25.0 °C(Predicted) | | density | 1.789±0.06 g/cm3(Predicted) | | refractive index | 1.567-1.569 | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | pka | 1.92±0.10(Predicted) | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C7H4BrFO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11) | | InChIKey | MDAZJVAIZVUWDE-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(F)C=CC=C1Br | | CAS DataBase Reference | 2252-37-1(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-36-25 | | Safety Statements | 37/39-26-45 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 29163990 |
| | 2-Bromo-6-fluorobenzoic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 2-Bromo-6-fluorobenzoic acid is an intermediate, mainly used in the industries such as medicine, agricultural chemicals at present. | | Synthesis | The synthesis and preparation method of the 2-bromo-6-fluorobenzoic acid comprises the following steps: by using o-fluorobenzonitrile as an initial raw material, carrying out nitrification, nitroreduction, bromization, diazo-deamination and hydrolysis to synthesize the 2-bromo-6-fluorobenzoic acid. | | References | [1] Organic Letters, 2009, vol. 11, # 5, p. 1051 - 1054 [2] Australian Journal of Chemistry, 2016, vol. 69, # 3, p. 307 - 313 [3] Synthesis, 2005, # 4, p. 617 - 621 [4] Tetrahedron Letters, 1996, vol. 37, # 36, p. 6551 - 6554 [5] ChemMedChem, 2010, vol. 5, # 10, p. 1693 - 1696 |
| | 2-Bromo-6-fluorobenzoic acid Preparation Products And Raw materials |
|