|
|
| | [(3,5-Dichlorophenyl)phenylmethyl]piperazine Basic information |
| Product Name: | [(3,5-Dichlorophenyl)phenylmethyl]piperazine | | Synonyms: | 1-[(3,5-DICHLORO-PHENYL)-PHENYL-METHYL]-PIPERAZINE;Piperazine, 1-[(3,5-dichlorophenyl)phenylmethyl]-;Lubiprostone Impurity 12;[(3,5-Dichlorophenyl)phenylmethyl]piperazine | | CAS: | 885950-04-9 | | MF: | C17H18Cl2N2 | | MW: | 321.24 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![[(3,5-Dichlorophenyl)phenylmethyl]piperazine Structure](StructureFile/ChemBookStructure4/GIF/CB5449703.gif) |
| | [(3,5-Dichlorophenyl)phenylmethyl]piperazine Chemical Properties |
| form | solid | | InChI | 1S/C17H18Cl2N2/c18-15-10-14(11-16(19)12-15)17(13-4-2-1-3-5-13)21-8-6-20-7-9-21/h1-5,10-12,17,20H,6-9H2 | | InChIKey | NKUCMZXLDJSIKD-UHFFFAOYSA-N | | SMILES | ClC1=CC(Cl)=CC(C(N2CCNCC2)C3=CC=CC=C3)=C1 |
| Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 |
| | [(3,5-Dichlorophenyl)phenylmethyl]piperazine Usage And Synthesis |
| | [(3,5-Dichlorophenyl)phenylmethyl]piperazine Preparation Products And Raw materials |
|