- 5-Fluoronicotinic acid
-
- $0.00 / 1kg
-
2025-12-29
- CAS:402-66-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: follow your request
- 5-Fluoronicotinic acid
-
- $1.10 / 1g
-
2025-11-18
- CAS:402-66-4
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | 5-Fluoronicotinic acid Basic information |
| | 5-Fluoronicotinic acid Chemical Properties |
| Melting point | 193-198℃ | | Boiling point | 272.2±20.0 °C(Predicted) | | density | 1.419±0.06 g/cm3(Predicted) | | RTECS | US5745250 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in methanol. | | form | Powder | | pka | 3.13±0.10(Predicted) | | color | Off-white | | InChI | InChI=1S/C6H4FNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10) | | InChIKey | BXZSBDDOYIWMGC-UHFFFAOYSA-N | | SMILES | C1=NC=C(F)C=C1C(O)=O | | CAS DataBase Reference | 402-66-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Fluoronicotinic acid Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 5-Fluoronicotinic acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals. |
| | 5-Fluoronicotinic acid Preparation Products And Raw materials |
|