| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:3,4-Epoxytetrahydrothiophene-1,1-dioxide CAS:4509-11-9 Purity:technical grade Package:1G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:3,4-Epoxytetrahydrothiophene-1,1-dioxide CAS:4509-11-9 Purity:technical grade Package:1G Remarks:145033-1G
|
|
| | 3,4-EPOXYTETRAHYDROTHIOPHENE-1,1-DIOXIDE Basic information |
| Product Name: | 3,4-EPOXYTETRAHYDROTHIOPHENE-1,1-DIOXIDE | | Synonyms: | 3,4-EPOXYTETRAHYDROTHIOPHENE-1,1-DIOXIDE;AKOS NCG1-0092;AKOS BBS-00004820;6-OXA-3-THIA-BICYCLO[3.1.0]HEXANE 3,3-DIOXIDE;IFLAB-BB F1294-0015;3,4-EPOXYTETRAHYDROTHIOPHENE-1,1-DIOXIDE , TECH.;2,3-Epoxy-1,4-butanediyl sulfone;6-Oxa-3-thiabicyclo[3.1.0]hexane,3,3-dioxide(6CI,7CI,8CI,9CI) | | CAS: | 4509-11-9 | | MF: | C4H6O3S | | MW: | 134.15 | | EINECS: | 224-827-3 | | Product Categories: | EPOXYDE;Epoxide Monomers;Monomers;Polymer Science;Epoxides;Organic Building Blocks;Oxygen Compounds | | Mol File: | 4509-11-9.mol |  |
| | 3,4-EPOXYTETRAHYDROTHIOPHENE-1,1-DIOXIDE Chemical Properties |
| Melting point | 145-150 °C (lit.) | | Boiling point | 113°C | | density | 1.272 (estimate) | | refractive index | 1.4661 (estimate) | | InChI | InChI=1S/C4H6O3S/c5-8(6)1-3-4(2-8)7-3/h3-4H,1-2H2 | | InChIKey | SZAIAWVGWTXVMB-UHFFFAOYSA-N | | SMILES | C12C(O1)CS(=O)(=O)C2 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | RP3850000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,4-EPOXYTETRAHYDROTHIOPHENE-1,1-DIOXIDE Usage And Synthesis |
| Uses | Used to prepare sulfolene derivatives and acyclic polyenes used in natural product synthesis. For a synthesis, see Tetrahedron Lett. |
| | 3,4-EPOXYTETRAHYDROTHIOPHENE-1,1-DIOXIDE Preparation Products And Raw materials |
|