| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | meso-1,2-Diphenyl-1,2-ethanediol Basic information |
| Product Name: | meso-1,2-Diphenyl-1,2-ethanediol | | Synonyms: | 1,2-Ethanediol, 1,2-diphenyl-, (R*,S*)-;meso-Stilbene glycol;1,2-DIPHENYL-1,2-ETHANEDIOL;MESO-1,2-DIPHENYLETHYLENE GLYCOL;MESO-1,2-DIPHENYL-1,2-ETHANEDIOL;HYDROBENZOIN MESO;1,2-Diphenyl-1,2-ethanediol (meso);MESO-HYDROBENZOIN / 1,2-DIPHENYL-1,2-ETHANEDIOL | | CAS: | 579-43-1 | | MF: | C14H14O2 | | MW: | 214.26 | | EINECS: | 207-758-3 | | Product Categories: | | | Mol File: | 579-43-1.mol |  |
| | meso-1,2-Diphenyl-1,2-ethanediol Chemical Properties |
| Melting point | 137-139 °C(lit.) | | Boiling point | 373.0±37.0 °C(Predicted) | | density | 1.193±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in hot alcohol or chloroform. | | form | Crystalline Powder | | pka | 13.38±0.20(Predicted) | | color | White | | Merck | 14,4777 | | BRN | 2050814 | | InChI | 1S/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14+ | | InChIKey | IHPDTPWNFBQHEB-OKILXGFUSA-N | | SMILES | O[C@H]([C@H](O)c1ccccc1)c2ccccc2 | | LogP | 1.910 | | CAS DataBase Reference | 579-43-1(CAS DataBase Reference) | | NIST Chemistry Reference | Meso-hydrobenzoin(579-43-1) |
| WGK Germany | 3 | | HS Code | 29062900 | | Storage Class | 11 - Combustible Solids |
| | meso-1,2-Diphenyl-1,2-ethanediol Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | meso- Hydrobenzoin has been used in the preparation of trans-methyl meso- hydrobenzoin phosphite. | | Definition | ChEBI: Meso-hydrobenzoin is a hydrobenzoin. | | General Description | Desymmetrization of meso-hydrobenzoin using chiral phosphine catalyst has been reported. Conversion of meso-hydrobenzoin to trans-stillbene oxide by treatment with an aryl sulfonyl chloride and aqueous sodium hydroxide has been reported. | | Purification Methods | meso-Hydrobenzoin [579-43-1] M 214.3, m 139o, 139-140o. Crystallise it from EtOH or water. [Beilstein 6 H 1003, 6 I 490, 6 II 967. 6 III 5429, 6 IV 6682.] |
| | meso-1,2-Diphenyl-1,2-ethanediol Preparation Products And Raw materials |
|