| Company Name: |
Nandana Bioscience (OPC) Private Limited
|
| Tel: |
+916363075789 |
| Email: |
basanagoudpatil@nandanabioscience.com |
| Products Intro: |
Product Name:2-Bromomethyl-anthraquinone
Purity:98% Package:5 kg, 25 kg, 100 kg and 1 MT
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:2-BroMoMethyl-anthraquinone
CAS:7598-10-9
Purity:97% Package:1G
|
2-(BROMOMETHYL)ANTHRAQUINONE manufacturers
|
| | 2-(BROMOMETHYL)ANTHRAQUINONE Basic information |
| | 2-(BROMOMETHYL)ANTHRAQUINONE Chemical Properties |
| Melting point | 203 °C (dec.) (lit.) | | Boiling point | 470.8±34.0 °C(Predicted) | | density | 1.597±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | BRN | 2276854 | | InChI | 1S/C15H9BrO2/c16-8-9-5-6-12-13(7-9)15(18)11-4-2-1-3-10(11)14(12)17/h1-7H,8H2 | | InChIKey | FCETXLHFBYOVCV-UHFFFAOYSA-N | | SMILES | BrCc1ccc2C(=O)c3ccccc3C(=O)c2c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 8 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-(BROMOMETHYL)ANTHRAQUINONE Usage And Synthesis |
| Purification Methods | Recrystallise the quinone from AcOH, wash the crystals with a little Et2O, dry it in air and then in a vacuum at 100o. It is prepared by bromination of 2-methylanthraquinone with Br2/PhNO2 at 145-150o, or N-bromosuccinimide in CCl4 containing a trace of (PhCOO)2. [Beilstein 7 IV 2576.] |
| | 2-(BROMOMETHYL)ANTHRAQUINONE Preparation Products And Raw materials |
|