- Fmoc-D-4-Fluorophe
-
- $2.20 / 100kg
-
2025-10-13
- CAS:177966-64-2
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
- FMOC-D-4-Fluorophe
-
- $0.00 / 1KG
-
2025-04-04
- CAS:177966-64-2
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- FMOC-D-4-Fluorophe
-
- $20.00 / 1KG
-
2019-07-06
- CAS:177966-64-2
- Min. Order: 10KG
- Purity: 99%
- Supply Ability: 100kg
|
| | FMOC-D-4-Fluorophe Basic information |
| | FMOC-D-4-Fluorophe Chemical Properties |
| Melting point | 180°C | | alpha | 35 º (c=1,DMF) | | Boiling point | 623.9±55.0 °C(Predicted) | | density | 1.2642 (estimate) | | storage temp. | 2-8°C | | pka | 3.75±0.10(Predicted) | | form | Powder | | color | White | | Optical Rotation | Consistent with structure | | Major Application | peptide synthesis | | InChI | 1S/C24H20FNO4/c25-16-11-9-15(10-12-16)13-22(23(27)28)26-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/t22-/m1/s1 | | InChIKey | IXUMACXMEZBPJG-JOCHJYFZSA-N | | SMILES | C(O)(=O)[C@@H](CC1=CC=C(F)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Hazard Note | Harmful | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | FMOC-D-4-Fluorophe Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | Fmoc-4-fluoro-d-phenylalanine, is an amino acid derivative, used in chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-D-4-Fluorophe Preparation Products And Raw materials |
|