|
|
| | DIMETHYL 2,6-NAPHTHALENEDICARBOXYLATE Basic information |
| Product Name: | DIMETHYL 2,6-NAPHTHALENEDICARBOXYLATE | | Synonyms: | 2,6-Dicarbomethoxynaphthalene;Dimethyl ester of 2,6-naphthalenedicarboxylic acid;dimethyl2,6-naphthalate;2,6-Naphthalenedicarboxylic acid, 2,6-dimethyl ester;DIMETHYL 2,6-NAPHTHALENEDICARBOXYLATE;DIMETHYL NAPHTHALENE-2,6-DICARBOXYLATE;2,6-NAPHTHALENEDICARBOXYLIC ACID DIMETHYL ESTER;2,6-NAPHTHALIC ACID DIMETHYL ESTER | | CAS: | 840-65-3 | | MF: | C14H12O4 | | MW: | 244.24 | | EINECS: | 212-661-4 | | Product Categories: | Building Blocks;C12 to C63;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;Naphthalene derivatives;C12 to C63;Carbonyl Compounds;Esters | | Mol File: | 840-65-3.mol |  |
| | DIMETHYL 2,6-NAPHTHALENEDICARBOXYLATE Chemical Properties |
| Melting point | 187-193 °C(lit.) | | Boiling point | 347.16°C (rough estimate) | | density | 1.2379 (rough estimate) | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.5389 (estimate) | | Fp | 232°C | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Soluble in hot toluene (very faint turbidity). Insoluble in water. | | BRN | 987259 | | Henry's Law Constant | 4.5×102 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C14H12O4/c1-17-13(15)11-5-3-10-8-12(14(16)18-2)6-4-9(10)7-11/h3-8H,1-2H3 | | InChIKey | GYUVMLBYMPKZAZ-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C(C(OC)=O)C=C2)=CC=C1C(OC)=O | | LogP | 3.5 at 25℃ | | CAS DataBase Reference | 840-65-3(CAS DataBase Reference) | | EPA Substance Registry System | Dimethyl 2,6-naphthalenedicarboxylate (840-65-3) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2917.39.7000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | DIMETHYL 2,6-NAPHTHALENEDICARBOXYLATE Usage And Synthesis |
| Uses | Dimethyl naphthalene-2,6-dicarboxylate is used as a pharmaceutical intermediate. | | Flammability and Explosibility | Non flammable | | Synthesis | To a round bottom flask was added 20 g of 2,6-naphthalenedicarboxylic acid dissolved in 150 mL of methanol and 15 mL of concentrated sulfuric acid was added as a catalyst. The reaction mixture was heated to reflux for 24 hours to complete the esterification reaction. Upon completion of the reaction, the mixture was slowly poured into 500 mL of ice water to quench the reaction. The resulting white precipitate was collected by diafiltration and washed with plenty of water to remove residual acid and methanol. Finally, the product was dried in a vacuum drying oven to give 20 g of dimethyl 2,6-naphthalenedicarboxylate in 89% yield. | | References | [1] Patent: CN103864711, 2016, B. Location in patent: Paragraph 0102; 0103; 0104
[2] RSC Advances, 2014, vol. 4, # 35, p. 18100 - 18107 |
| | DIMETHYL 2,6-NAPHTHALENEDICARBOXYLATE Preparation Products And Raw materials |
|