|
|
| | MERCUROUS NITRATE, DIHYDRATE Basic information |
| Product Name: | MERCUROUS NITRATE, DIHYDRATE | | Synonyms: | MERCUROUS NITRATE, DIHYDRATE, REAGENTMERCUROUS NITRATE, DIHYDRATE, REAGENTMERCUROUS NITRATE, DIHYDRATE, REAGENTMERCUROUS NITRATE, DIHYDRATE, REAGENT;mercury(1+),nitric acid,dihydrate;MERCUROUS NITRATE 2HYD XTL;Mercury(II)nitratedihydrate;MERCURY(I) NITRATE DIHYDRATE 97+% &;MERCURY(I) NITRATE DIHYDRATE, GR ACS 98%;Mercurous niotrate,dihydrous;mercury(i) nitrate dihydrate, acs | | CAS: | 14836-60-3 | | MF: | H4HgNO5 | | MW: | 298.63 | | EINECS: | 233-886-4 | | Product Categories: | | | Mol File: | 14836-60-3.mol |  |
| | MERCUROUS NITRATE, DIHYDRATE Chemical Properties |
| Melting point | 70 °C | | density | 4,79 g/cm3 | | vapor density | 1.9 (vs air) | | RTECS | OW8000000 | | solubility | slightly soluble in H2O | | form | Crystalline | | color | White crystals | | Odor | Odorless or slight nitric acid odor | | Water Solubility | Slightly soluble in water. | | Sensitive | Light Sensitive | | Merck | 14,5896 | | Exposure limits | ACGIH: TWA 0.025 mg/m3 (Skin)
NIOSH: IDLH 10 mg/m3; TWA 0.05 mg/m3; Ceiling 0.1 mg/m3 | | InChI | 1S/Hg.NO3.H2O/c;2-1(3)4;/h;;1H2/q+1;-1; | | InChIKey | UPCSQZXLTBTBCU-UHFFFAOYSA-N | | SMILES | [Hg+].[H]O[H].[O-][N+]([O-])=O | | CAS DataBase Reference | 14836-60-3(CAS DataBase Reference) |
| Hazard Codes | N-T+ | | Risk Statements | 50/53-33-26/27/28 | | Safety Statements | 61-60-45-13 | | RIDADR | 1627 | | WGK Germany | WGK 3 | | TSCA | Yes | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 28521000 | | Storage Class | 6.1B - Non-combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal
Acute Tox. 2 Inhalation
Acute Tox. 2 Oral
Aquatic Acute 1
Aquatic Chronic 1
STOT RE 2 |
| | MERCUROUS NITRATE, DIHYDRATE Usage And Synthesis |
| Chemical Properties | White to yellow crystalline powder | | Uses | Mercury(I) nitrate dihydrate is used in the preparation of other mercury(I) compounds. It acts as a reducing agent. It is involved in the preparation of mercury(II) nitrate by treating with dilute nitric acid as well as to get mercury on exposure to light. | | reaction suitability | reagent type: catalyst
core: mercury |
| | MERCUROUS NITRATE, DIHYDRATE Preparation Products And Raw materials |
|