L-Ascorbic acid 6-stearate manufacturers
|
| | L-Ascorbic acid 6-stearate Basic information |
| Product Name: | L-Ascorbic acid 6-stearate | | Synonyms: | 6-(stearoyloxy)-L-ascorbic acid;4,5-dihydroxy-2-(1-hydroxy-2-octadecoxyethyl)-3-furanone;6-O-Stearoyl-L-ascorbic Acid;[2-(4,5-dihydroxy-3-oxo-furan-2-yl)-2-hydroxy-ethyl] octadecanoate;[2-(4,5-dihydroxy-3-oxofuran-2-yl)-2-hydroxyethyl] octadecanoate;stearic acid [2-(4,5-dihydroxy-3-keto-2-furyl)-2-hydroxy-ethyl] ester;6-o-stearylascorbic acid;6-O-STEAROYL-L-ASCORBIC ACID | | CAS: | 10605-09-1 | | MF: | C24H42O7 | | MW: | 442.59 | | EINECS: | 234-231-5 | | Product Categories: | Biochemistry;Sugar Acids;Sugars | | Mol File: | 10605-09-1.mol |  |
| | L-Ascorbic acid 6-stearate Chemical Properties |
| Melting point | 117 °C | | Boiling point | 536.0±50.0 °C(Predicted) | | density | 1.125 | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 3.96±0.10(Predicted) | | color | White to Pale Brown | | Major Application | (Pharmaceutical small molecule) | | InChI | InChI=1S/C24H42O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(26)30-18-19(25)23-21(27)22(28)24(29)31-23/h19,23,25,27-28H,2-18H2,1H3/t19-,23+/m0/s1 | | InChIKey | LITUBCVUXPBCGA-WMZHIEFXSA-N | | SMILES | OC1=C(O)C(=O)O[C@@H]1[C@H](COC(=O)CCCCCCCCCCCCCCCCC)O |
| WGK Germany | WGK 3 | | RTECS | CI7671310 | | HS Code | 2936270000 | | Storage Class | 11 - Combustible Solids |
| | L-Ascorbic acid 6-stearate Usage And Synthesis |
| Uses | L-Ascorbic Acid 6-Stearate is used to specifically target anti-tumoral dehydrocrotonin nanoparticles. | | Definition | ChEBI: Ascorbyl stearate is a fatty acid ester. |
| | L-Ascorbic acid 6-stearate Preparation Products And Raw materials |
|