|
|
| | 3-(Trifluoromethoxy)chlorobenzene Basic information |
| Product Name: | 3-(Trifluoromethoxy)chlorobenzene | | Synonyms: | 3-(TRIFLUOROMETHOXY)CHLOROBENZENE;3-CHLORO-ALPHA,ALPHA,ALPHA-TRIFLUOROANISOLE;3-(Trifluoromethoxy)chlorobenzene 97%;3-(Trifluoromethoxy)chlorobenzene97%;BENZENE,1-CHLORO-3-(TRIFLUOROMETHOXY);1-chloro-2-(trifluoromethoxyl)benzene;1-Chloro-2-(Trifluoromethox;M-chloro(trifluoroMethoxy)benzene | | CAS: | 772-49-6 | | MF: | C7H4ClF3O | | MW: | 196.55 | | EINECS: | 231-788-6 | | Product Categories: | | | Mol File: | 772-49-6.mol |  |
| | 3-(Trifluoromethoxy)chlorobenzene Chemical Properties |
| Boiling point | 44-46°C 15mm | | density | 1.37 | | refractive index | 1.4360 | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | Appearance | Light yellow to yellow Liquid | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C7H4ClF3O/c8-5-2-1-3-6(4-5)12-7(9,10)11/h1-4H | | InChIKey | OLDJEKBXICPMAS-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=CC(OC(F)(F)F)=C1 | | CAS DataBase Reference | 772-49-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 1993 | | HazardClass | IRRITANT | | PackingGroup | III | | HS Code | 29039990 |
| | 3-(Trifluoromethoxy)chlorobenzene Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liquid | | Uses | 1-Chloro-3-(trifluoromethoxy)benzene is used as pharmaceutical intermediate. |
| | 3-(Trifluoromethoxy)chlorobenzene Preparation Products And Raw materials |
|