- 1-Chloro-2,6-difluorobenzene
-
- $101.00 / 1KG
-
2025-09-25
- CAS:38361-37-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Chloro-1,3-difluorobenzene Basic information |
| Product Name: | 2-Chloro-1,3-difluorobenzene | | Synonyms: | 2,6-FluMethrin;2,6-Difluorochlorobenzene 98%;1-CHLORO-2,6-DIFLUOROBENZENE;2,6-DIFLUOROCHLOROBENZENE;CHLORO-2,6-DIFLUOROBENZENE;2-CHLORO-1,3-DIFLUOROBENZENE;1-CHLORO-2,6-DIFLUOROBENZENE / 2,6-DIFLUOROCHLOROBENZENE;Benzene, 2-chloro-1,3-difluoro- | | CAS: | 38361-37-4 | | MF: | C6H3ClF2 | | MW: | 148.54 | | EINECS: | 233-305-4 | | Product Categories: | Aromatic Hydrocarbons (substituted) & Derivatives;Chlorine Compounds;Fluorine Compounds | | Mol File: | 38361-37-4.mol |  |
| | 2-Chloro-1,3-difluorobenzene Chemical Properties |
| Boiling point | 126-128 | | density | 1.37 | | refractive index | 1.4780-1.4820 | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C6H3ClF2/c7-6-4(8)2-1-3-5(6)9/h1-3H | | InChIKey | OTZQYBFTOANOJO-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(F)=C1Cl | | CAS DataBase Reference | 38361-37-4(CAS DataBase Reference) |
| Hazard Codes | F | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | 1993 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2903998090 |
| | 2-Chloro-1,3-difluorobenzene Usage And Synthesis |
| Uses |
2-Chloro-1,3-difluorobenzene is a colorless to pale yellow liquid and a valuable trihalogenated benzene derivative.
|
| | 2-Chloro-1,3-difluorobenzene Preparation Products And Raw materials |
|