- N-Phthalylglycyl chloride
-
- $0.00 / 25kgs/paper drum
-
2026-05-21
- CAS:6780-38-7
- Min. Order: 25kgs/paper drum
- Purity: 97%
- Supply Ability: 20 tons
|
| | Phthalylglycyl chloride Basic information |
| | Phthalylglycyl chloride Chemical Properties |
| Melting point | 84-85 °C | | Boiling point | 190-192 °C(Press: 15 Torr) | | density | 1.504±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform, Dichloromethane | | pka | -2.56±0.20(Predicted) | | form | Solid | | color | White | | InChI | 1S/C10H6ClNO3/c11-8(13)5-12-9(14)6-3-1-2-4-7(6)10(12)15/h1-4H,5H2 | | InChIKey | RHZBRCQIKQUQHQ-UHFFFAOYSA-N | | SMILES | ClC(=O)CN1C(=O)c2ccccc2C1=O |
| Hazard Codes | T | | Risk Statements | 25-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2923 8/PG 3 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Dam. 1
Skin Corr. 1B |
| | Phthalylglycyl chloride Usage And Synthesis |
| Chemical Properties | slight yellow to white crystalline powder | | Uses | Reactant involved in:• ;Synthesis of selenium-containing amino acid analogs with bactericidal and antifungal activity1• ;Photoinduced single electron transfer cyclization for preparation of cyclic peptides2• ;Arndt-Eistert synthesis3• ;Mitsunobu and arbuzov-type multicomponent pathway4• ;Remote C-H bond functionalization5• ;Amido-alkylation for synthesis of benzofuran derivatives6 | | Uses | Phthalylglycyl chloride can be used in the synthesis of N-Phthalimidoacetyl-β-phenylethylamnine. | | General Description | Phthalylglycyl chloride can be synthesized via reaction of phthalyl-glycine with thionyl chloride. |
| | Phthalylglycyl chloride Preparation Products And Raw materials |
|