- 4'-Ethoxyacetophenone
-
- $0.00 / 1KG
-
2026-03-06
- CAS:1676-63-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- 4′-Ethoxyacetophenone
-
- $0.00 / 25kg
-
2025-12-01
- CAS:1676-63-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- 4'-Ethoxyacetophenone
-
- $40.00 / 1kg
-
2025-06-20
- CAS:1676-63-7
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10 tons
|
| | 4′-Ethoxyacetophenone Basic information |
| | 4′-Ethoxyacetophenone Chemical Properties |
| Melting point | 37-39 °C (lit.) | | Boiling point | 268-269 °C/758 mmHg (lit.) | | density | 1.0326 (rough estimate) | | refractive index | 1.5180 (estimate) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | Soluble in alcohol, water(791.1 mg/L). | | BRN | 636783 | | InChI | InChI=1S/C10H12O2/c1-3-12-10-6-4-9(5-7-10)8(2)11/h4-7H,3H2,1-2H3 | | InChIKey | YJFNFQHMQJCPRG-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(OCC)C=C1)C | | CAS DataBase Reference | 1676-63-7(CAS DataBase Reference) | | NIST Chemistry Reference | Ethanone, 1-(4-ethoxyphenyl)-(1676-63-7) | | EPA Substance Registry System | 4'-Ethoxy acetophenone (1676-63-7) |
| | 4′-Ethoxyacetophenone Usage And Synthesis |
| Chemical Properties | white to yellow crystals and chunks or | | Uses | 4'-Ethoxyacetophenone is used to produce 4-(4-ethoxy-phenyl)-thiazol-2-ylamine. |
| | 4′-Ethoxyacetophenone Preparation Products And Raw materials |
|