| Company Name: |
Guangzhou Isun Pharmaceutical Co., Ltd
|
| Tel: |
020-39119399 18927568969 |
| Email: |
isunpharm@qq.com |
| Products Intro: |
Product Name:D-Ala2, D-Leu5]-Enkephalin acetate salt CAS:94825-57-7 Purity:>=95% (HPLC) Package:5Mg;10Mg;25Mg;50Mg;100Mg;1g;5g;10g;25g
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:[D-Ala2, D-Leu5]-Enkephalin CAS:94825-57-7 Purity:>= 95 % HPLC Package:0.5mg, 1mg, 5mg, 25mg Remarks:E7131
|
| Company Name: |
Enzo Biochem Inc
|
| Tel: |
Enzo Biochem Inc. 13797054060 |
| Email: |
Enzoname@qq.com |
| Products Intro: |
Product Name:[D-Ala2,D-Leu5]-Enkephalin CAS:94825-57-7
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:[D-Ala2, D-Leu5]-Enkephalin acetate salt CAS:94825-57-7
|
|
| | TYR-D-ALA-GLY-PHE-D-LEU ACETATE SALT Basic information |
| Product Name: | TYR-D-ALA-GLY-PHE-D-LEU ACETATE SALT | | Synonyms: | [D-ALA2, D-LEU5]-ENKEPHALIN ACETATE SALT;TYR-D-ALA-GLY-PHE-D-LEU ACETATE SALT;(D-ALA2, D-LEU5)-ENKEPHALIN ACETATE;(D-alanine2,D-leucine5)enkephalin;[D-Ala2, D-Leu5]-Enkephalin acetate salt,DADLE;(2R)-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid;[D-Ala2, D-Leu5]-Enkephalin acetate salt | | CAS: | 94825-57-7 | | MF: | C31H43N5O9 | | MW: | 629.71 | | EINECS: | | | Product Categories: | | | Mol File: | 94825-57-7.mol |  |
| | TYR-D-ALA-GLY-PHE-D-LEU ACETATE SALT Chemical Properties |
| storage temp. | −20°C | | InChIKey | YRZBXSPTRALQEX-IIKZURRYSA-N | | SMILES | CC(O)=O.CC(C)C[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](C)NC(=O)[C@@H](N)Cc2ccc(O)cc2)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | TYR-D-ALA-GLY-PHE-D-LEU ACETATE SALT Usage And Synthesis |
| Uses | [D-Ala2, D-Leu5]-Enkephalin or DADLE has been used for use in immunocomplex kinetic assay, to determine the activation of p70s6k by DADLE in the cell clones D2 and DOE and in non-transfected parental Rat-1 fibroblasts and to assess the analgesic effect of WIN55,212-2 in mice. | | General Description | [D-Ala2, D-Leu5]-Enkephalin acetate salt, also called DADLE, is an analog of endogenous δ-opioid peptide encephalin, and is metabolically stable. | | Biochem/physiol Actions | [D-Ala2, D-Leu5]-Enkephalin can induce hibernation in ground squirrels, during summers, when they do not normally hibernate. In multiorgan block preparation, it can prolong the survival time of organs such as, heart, lung, liver, spleen and kidney, up to 46hrs. It aids in tolerance development of myocardium to ischemia. It might have tissue protective role in central nervous system. It prevents and reverses methamphetamine (METH)-induced damage of dopaminergic terminals of brain. It prevents naltrexone-sensitive PC12 cell apoptosis in serum deprivation conditions. Thus, it might play an essential role in the survival of neurons and organs. |
| | TYR-D-ALA-GLY-PHE-D-LEU ACETATE SALT Preparation Products And Raw materials |
|