- 2,6-Dithiopurine
-
- $3.00 / 1KG
-
2020-01-08
- CAS:5437-25-2
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 200KG
|
| | 2,6-Dithiopurine Basic information |
| Product Name: | 2,6-Dithiopurine | | Synonyms: | 2,6-DIMERCAPTOPURINE;2,6-THIOPURINE;2,6-PURINEDITHIOL;2,6-DITHIOPURINE;2,6-DITHIOXANTHINE;9H-PURINE-2,6-DITHIOL;DITHIOXANTHINE;2,6-PURINEDITHIOL 98% | | CAS: | 5437-25-2 | | MF: | C5H4N4S2 | | MW: | 184.24 | | EINECS: | 226-608-8 | | Product Categories: | Purine;API intermediates;Purines;Pyridines, Pyrimidines, Purines and Pteredines;FINE Chemical & INTERMEDIATES | | Mol File: | 5437-25-2.mol |  |
| | 2,6-Dithiopurine Chemical Properties |
| Melting point | >350 °C(lit.) | | Boiling point | 496.2±37.0 °C(Predicted) | | density | 1.541 (estimate) | | refractive index | 1.5605 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | slightly soluble | | form | Powder | | pka | 6.77±0.20(Predicted) | | color | Pale yellow | | Water Solubility | slightly soluble | | InChI | InChI=1S/C5H4N4S2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11) | | InChIKey | VQPMXSMUUILNFZ-UHFFFAOYSA-N | | SMILES | N1C2=C(NC(=S)NC2=S)NC=1 | | CAS DataBase Reference | 5437-25-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | UO8475000 | | HS Code | 29335990 |
| | 2,6-Dithiopurine Usage And Synthesis |
| Chemical Properties | light brown powder | | Uses | 2,6-Dimercaptopurine can be used in theoretical evaluation of inhibition performance of purine corrosion inhibitors for mild steel. |
| | 2,6-Dithiopurine Preparation Products And Raw materials |
|