|
|
| | 3-Bromo-5-chlorosalicylaldehyde Basic information |
| | 3-Bromo-5-chlorosalicylaldehyde Chemical Properties |
| Melting point | 85-88 °C (lit.) | | Boiling point | 245.3±35.0 °C(Predicted) | | density | 1.7312 (rough estimate) | | refractive index | 1.5590 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 6.20±0.23(Predicted) | | color | White to Light yellow to Green | | Sensitive | Air Sensitive | | BRN | 2362159 | | InChI | InChI=1S/C7H4BrClO2/c8-6-2-5(9)1-4(3-10)7(6)11/h1-3,11H | | InChIKey | KNOYZLVIXXBBIB-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(Cl)=CC(Br)=C1O | | CAS DataBase Reference | 19652-32-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant/Air Sensitive | | HS Code | 29130000 |
| | 3-Bromo-5-chlorosalicylaldehyde Usage And Synthesis |
| Chemical Properties | yellow flakes | | Uses | 3-Bromo-5-chlorosalicylaldehyde may be used in the synthesis of the following Schiff base compounds:
- 2-bromo-4-chloro-6-[(E)-o-tolyl-imino-meth-yl]phenol
- 2-bromo-4-chloro-6-[(1-phenyl-ethyl)-imino-meth-yl]phenol
- 2-bromo-4-chloro-6-[(E)-(2-chloro-phen-yl)imino-meth-yl]phenol
- 2′-(3-bromo-5-chloro-2-hydroxy-benzyl-idene)isonicotinohydrazide methanol solvate
| | General Description | 3-Bromo-5-chlorosalicylaldehyde is a substituted salicyladehyde. |
| | 3-Bromo-5-chlorosalicylaldehyde Preparation Products And Raw materials |
|