Dodecanedioic acid, 1-(phenylmethyl) ester manufacturers
|
| | Dodecanedioic acid, 1-(phenylmethyl) ester Basic information |
| Product Name: | Dodecanedioic acid, 1-(phenylmethyl) ester | | Synonyms: | Dodecanedioic acid, 1-(phenylmethyl) ester;11-((benzyloxy)carbonyl)undecanoic acid;12-(Benzyloxy)-12-oxododecanoic Acid;Dodecanedioic acid, mono(phenylmethyl) ester;12-oxo-12-phenylmethoxydodecanoate;1,12-Dodecanedioic acid monobenzyl ester;12-oxo-12-phenylmethoxydodecanoic acid;dodecanediacidbenzyl ester | | CAS: | 88353-04-2 | | MF: | C19H28O4 | | MW: | 320.42 | | EINECS: | 618-148-5 | | Product Categories: | Other | | Mol File: | 88353-04-2.mol |  |
| | Dodecanedioic acid, 1-(phenylmethyl) ester Chemical Properties |
| Melting point | 65-66 °C | | Boiling point | 457.6±18.0 °C(Predicted) | | density | 1.061±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.78±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C19H28O4/c20-18(21)14-10-5-3-1-2-4-6-11-15-19(22)23-16-17-12-8-7-9-13-17/h7-9,12-13H,1-6,10-11,14-16H2,(H,20,21) | | InChIKey | ZDTVBXVYNIHVNR-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)CCCCCCCCCCC(O)=O |
| | Dodecanedioic acid, 1-(phenylmethyl) ester Usage And Synthesis |
| | Dodecanedioic acid, 1-(phenylmethyl) ester Preparation Products And Raw materials |
|