L-Cysteine-2,3,3-d3 manufacturers
- L-Cysteine-D3
-
-
2026-07-15
- CAS:214782-32-8
- Purity:
- Supply Ability: 10g
|
| | L-Cysteine-2,3,3-d3 Basic information |
| Product Name: | L-Cysteine-2,3,3-d3 | | Synonyms: | L-Cysteine-2,3,3-d3;D3-L-Cysteine;L-Cysteine (2,3,3-D?, 98%);L-Cysteine-2,3,3-d3;L-Cysteine-D3 (Standard) | | CAS: | 214782-32-8 | | MF: | C3H4D3NO2S | | MW: | 124.18 | | EINECS: | 633-664-0 | | Product Categories: | | | Mol File: | 214782-32-8.mol |  |
| | L-Cysteine-2,3,3-d3 Chemical Properties |
| Melting point | 220°C | | Boiling point | 293.883±35.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.335±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | form | Solid | | pka | 2.069±0.10(predicted) | | color | White to off-white | | InChI | 1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1/i1D2,2D | | InChIKey | XUJNEKJLAYXESH-RBXBQAPRSA-N | | SMILES | [2H]C([2H])(S)[C@]([2H])(N)C(O)=O | | CAS Number Unlabeled | 52-90-4 |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | L-Cysteine-2,3,3-d3 Usage And Synthesis |
| Uses | L-Cysteine-d3 is the deuterium labeled L-Cysteine. L-Cysteine is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine suppresses ghrelin and reduces appetite in rodents and humans[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-Cysteine-2,3,3-d3 Preparation Products And Raw materials |
|