|
|
| | 2,6-Dimethyl-4-hydroxybenzaldehyde Basic information |
| Product Name: | 2,6-Dimethyl-4-hydroxybenzaldehyde | | Synonyms: | TIMTEC-BB SBB008519;2,6-DIMETHYL-4-HYDROXYBENZALDEHYDE;2,6-Dimethyl-4-hydrobenzaldehyde;4-Hydroxy-2,6-Dimethyl Benzaldehyde 2,6-Dimethyl-4-Hydroxy Benzaldehyde;4-HYROXY-2,6-DIMETHYLBENZALDEHYDE;Benzaldehyde, 4-hydroxy-2,6-dimethyl- (6CI, 7CI, 9CI);2,6-DIMETHYL-4-HYDROXYBENZALDEHEYDE;2,6-Dimethyl-4-hydroxybenzaldehyde ,98% | | CAS: | 70547-87-4 | | MF: | C9H10O2 | | MW: | 150.17 | | EINECS: | 639-426-2 | | Product Categories: | Aromatic Aldehydes & Derivatives (substituted);Benzaldehyde;CHIRAL CHEMICALS;ALDEHYDE | | Mol File: | 70547-87-4.mol |  |
| | 2,6-Dimethyl-4-hydroxybenzaldehyde Chemical Properties |
| Melting point | 190-196°C | | Boiling point | 231.72°C (rough estimate) | | density | 1.0858 (rough estimate) | | refractive index | 1.5180 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 8.02±0.23(Predicted) | | form | solid | | color | beige | | InChI | InChI=1S/C9H10O2/c1-6-3-8(11)4-7(2)9(6)5-10/h3-5,11H,1-2H3 | | InChIKey | XXTRGLCPRZQPHJ-UHFFFAOYSA-N | | SMILES | C(=O)C1=C(C)C=C(O)C=C1C | | CAS DataBase Reference | 70547-87-4(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2912490090 | | Storage Class | 11 - Combustible Solids |
| | 2,6-Dimethyl-4-hydroxybenzaldehyde Usage And Synthesis |
| Uses | 2,6-Dimethyl-4-hydroxybenzaldehydeis a value compound that could synthesis 4-Methoxy-2,6-dimethylbenzaldehyde, 2,6-Dimethyl-4-methoxybenzoic acid, and so on.
| | Application | 2,6-Dimethyl-4-hydroxybenzaldehyde can be used for proteomics research.
| | Hazard |
2,6-Dimethyl-4-hydroxybenzaldehyde causes skin irritation and serious eye irritation. It may cause respiratory irritation.
|
| | 2,6-Dimethyl-4-hydroxybenzaldehyde Preparation Products And Raw materials |
|