|
|
| | tert-butyl N-(2-amino-3,3,3-trifluoropropyl)carbamate Basic information |
| Product Name: | tert-butyl N-(2-amino-3,3,3-trifluoropropyl)carbamate | | Synonyms: | tert-butyl N-(2-amino-3,3,3-trifluoropropyl)carbamate;tert-Butyl (2-amino-3,3,3-trifluoropropyl)carbamate;(2-Amino-3,3,3-trifluoro-propyl)-carbamic acid tert-butyl ester;Carbamic acid, N-(2-amino-3,3,3-trifluoropropyl)-, 1,1-dimethylethyl ester | | CAS: | 1279818-32-4 | | MF: | C8H15F3N2O2 | | MW: | 228.21 | | EINECS: | | | Product Categories: | | | Mol File: | 1279818-32-4.mol |  |
| | tert-butyl N-(2-amino-3,3,3-trifluoropropyl)carbamate Chemical Properties |
| Boiling point | 278.9±40.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | pka | 11.82±0.46(Predicted) | | InChI | InChI=1S/C8H15F3N2O2/c1-7(2,3)15-6(14)13-4-5(12)8(9,10)11/h5H,4,12H2,1-3H3,(H,13,14) | | InChIKey | CULJFUHYDUYEEV-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCC(N)C(F)(F)F |
| | tert-butyl N-(2-amino-3,3,3-trifluoropropyl)carbamate Usage And Synthesis |
| | tert-butyl N-(2-amino-3,3,3-trifluoropropyl)carbamate Preparation Products And Raw materials |
|