| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Fmoc-L-Photo-Leucine manufacturers
- Fmoc-L-photo-leucine
-
- $2.00
-
2026-08-25
- CAS:1360651-24-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | Fmoc-L-Photo-Leucine Basic information |
| Product Name: | Fmoc-L-Photo-Leucine | | Synonyms: | Fmoc-L-Photo-Leucine;3H-Diazirine-3-propanoic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-3-methyl-, (αS)-;L-PhotoLeu-OH;Fmoc-L-photo-Leu;Fmoc-L-photo-leucine;(S)-2-(Fmoc-amino)-3-(3H-diazirin-3-yl)butanoic acid, Fmoc-Photo-Leu, Fmoc-Photo-Leu-OH | | CAS: | 1360651-24-6 | | MF: | C20H19N3O4 | | MW: | 365.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1360651-24-6.mol |  |
| | Fmoc-L-Photo-Leucine Chemical Properties |
| density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.67±0.10(Predicted) | | form | powder | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C20H19N3O4/c1-20(22-23-20)10-17(18(24)25)21-19(26)27-11-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16-17H,10-11H2,1H3,(H,21,26)(H,24,25)/t17-/m0/s1 | | InChIKey | GDWMJFRPAHGSDU-KRWDZBQOSA-N | | SMILES | N([C@@H](CC4(N=N4)C)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-L-Photo-Leucine Usage And Synthesis |
| Uses | Fmoc-L-Photo-Leucine is a diazirine-containing, Fmoc-protected leucine amino acid and multifunctional photo-crosslinker. Its incorporation into peptides or small-molecule probes and tools allows for photoaffinity labeling of cellular targets and protein-protein interactions upon UV light (～360 nm) irradiation to form a covalent bond. This and other multifunctional probe building blocks will continue to accelerate drug discovery research for probing cellular mechanisms, target ID/validation, and understanding traditionally undruggable targets. An unprotected version is also available as 907278. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-L-Photo-Leucine Preparation Products And Raw materials |
|