| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
GSK 983) manufacturers
- GSK983
-
- $1070.00
-
2026-07-27
- CAS:827591-02-6
- Purity:
- Supply Ability: 10g
|
| | GSK 983) Basic information |
| Product Name: | GSK 983) | | Synonyms: | GSK 983);GSK983
(GSK-983;GSK983 >=98% (HPLC);2-Pyridinecarboxamide, N-[(1R)-6-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-;2'-chloro-6',7'-dihydrospiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-6'-one | | CAS: | 827591-02-6 | | MF: | C18H16ClN3O | | MW: | 325.79 | | EINECS: | | | Product Categories: | | | Mol File: | 827591-02-6.mol |  |
| | GSK 983) Chemical Properties |
| Boiling point | 627.1±55.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 10mg/mL, clear | | form | Solid | | pka | 13.10±0.20(Predicted) | | color | White to light yellow | | Optical Rotation | [α]/D +175 to +195°, c =1 in methylene chloride | | InChI | 1S/C18H16ClN3O/c19-11-7-8-14-13(10-11)12-4-3-6-15(17(12)21-14)22-18(23)16-5-1-2-9-20-16/h1-2,5,7-10,15,21H,3-4,6H2,(H,22,23) | | InChIKey | WJQBOBGVBBZLJU-UHFFFAOYSA-N | | SMILES | ClC1=CC=C(NC2=C3CCC[C@H]2NC(C4=NC=CC=C4)=O)C3=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | GSK 983) Usage And Synthesis |
| Description | GSK983 is a potent broad-spectrum antiviral. It blocks cell proliferation and dengue virus replication by inhibiting the pyrimidine biosynthesis enzyme dihydroorotate dehydrogenase (DHODH). | | Uses | GSK983 is a broad-spectrum antiviral agent. GSK983 inhibits the replication of adenovirus-5 (Ad-5) and polyoma virus SV40. GSK983 inhibits the growth of cell lines immortalized by
EBV, HTLV1, HPV. GSK983 induces the expression of interferon-stimulated genes[1]. | | References | [1] Harvey R,et al. GSK983: a novel compound with broad-spectrum antiviral activity. Antiviral Res. 2009 Apr;82(1):1-11. DOI:10.1016/j.antiviral.2008.12.015 |
| | GSK 983) Preparation Products And Raw materials |
|