| Company Name: |
ChemShuttle, Inc.
|
| Tel: |
0510-83588313-811 18800520310 |
| Email: |
sales@chemshuttle.com |
| Products Intro: |
Product Name:1-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)amino)-3,6,9,12-tetraoxapentadecan-15-oic acid
CAS:2138440-81-8
Purity:95% Package:5mg;25mg;100mg;500mg;1g;5g;10g;25g;50g;100g;250g;500g;kg… Remarks:ID:191449
|
Pomalidomide-PEG4-CO2H manufacturers
- Pomalidomide-PEG4-COOH
-
- $0.00 / 250mg
-
2025-06-07
- CAS:2138440-81-8
- Min. Order: 250mg
- Purity: >98.00%
- Supply Ability: 250mg
|
| | Pomalidomide-PEG4-CO2H Basic information |
| Product Name: | Pomalidomide-PEG4-CO2H | | Synonyms: | POMALIDOMIDE-PEG4-CO 2 H;Pomalidomide-PEG4-CO2H;Pomalidomide-PEG4-COOH;1-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)amino)-3,6,9,12-tetraoxapentadecan-15-oic acid;Thalidomide-NH-PEG4-C2-COOH;Propanoic acid, 3-[2-[2-[2-[2-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-;1-[[2-(2,6-Dioxo-3-piperidyl)-1,3-dioxo-4-isoindolinyl]amino]-3,6,9,12-tetraoxapentadecan-15-oic Acid;1-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)amino)-3,6,9,12-tetraoxapentadecan-15-oic acid, Crosslinker–E3 Ligase ligand conjugate, Protein degrader building block for PROTAC? research, Template for synthesis of targeted protein degrader | | CAS: | 2138440-81-8 | | MF: | C24H31N3O10 | | MW: | 521.52 | | EINECS: | | | Product Categories: | peg | | Mol File: | 2138440-81-8.mol |  |
| | Pomalidomide-PEG4-CO2H Chemical Properties |
| Boiling point | 773.6±60.0 °C(Predicted) | | density | 1.385±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.28±0.10(Predicted) | | form | Viscous Liquid | | color | Light yellow to yellow | | InChIKey | CAANPUBZFFRWQP-UHFFFAOYSA-N | | SMILES | O=C(C(CC1)N(C2=O)C(C3=C2C=CC=C3NCCOCCOCCOCCOCCC(O)=O)=O)NC1=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Pomalidomide-PEG4-CO2H Usage And Synthesis |
| Uses | Protein degrader builiding block Pomalidomide-PEG4-CO2H enables the synthesis of molecules for targeted protein degradation and PROTAC (proteolysis-targeting chimeras) technology.This conjugate contains a Cereblon (CRBN)-recruiting ligand and a PEGylated crosslinker with pendant carboxylic acid for reactivity with an amine on the target ligand. Because even slight alterations in ligands and crosslinkers can affect ternary complex formation between the target, E3 ligase, and PROTAC, many analogs are prepared to screen for optimal target degradation. When used with other protein degrader building blocks with a pendant carboxyl group, parallel synthesis can be used to more quickly generate PROTAC libraries that feature variation in crosslinker length, composition and E3 ligase ligand. | | reaction suitability | reactivity: amine reactive
reagent type: ligand-linker conjugate | | storage | Desiccate at RT |
| | Pomalidomide-PEG4-CO2H Preparation Products And Raw materials |
|