| Company Name: |
YANGZHOU HENGCHUAN CHEMICAL CO., LTD. Gold
|
| Tel: |
13775575144 |
| Email: |
59033115@qq.com |
| Products Intro: |
Product Name:4-Nitrobenzyl bromide
CAS:100-11-8
Purity:99% Package:25KG;1000KG
|
| Company Name: |
Shanghai Macklin Biochemical Co.,Ltd.
|
| Tel: |
15221275939 |
| Email: |
shenlinxing@macklin.cn |
| Products Intro: |
Product Name:4-Nitrobenzyl bromide
CAS:100-11-8
Purity:99% Package:100g；25g；500g；5g；2.5kg
|
|
| | 4-Nitrobenzyl bromide Basic information |
| | 4-Nitrobenzyl bromide Chemical Properties |
| Melting point | 98 °C | | Boiling point | 265.51°C (rough estimate) | | density | 1.6841 (rough estimate) | | refractive index | 1.6120 (estimate) | | storage temp. | Store at RT. | | solubility | soluble in Chloroform, Ethyl Acetate | | form | Crystalline Powder | | color | Light yellow to beige | | Water Solubility | It hydrolyzes in water. Soluble in alcohol and ether. | | BRN | 742796 | | Stability: | Stable. Incomaptible with bases, amines, oxidizing agents, alcohols. May be moisture sensitive. Corrodes steel. | | InChI | InChI=1S/C7H6BrNO2/c8-5-6-1-3-7(4-2-6)9(10)11/h1-4H,5H2 | | InChIKey | VOLRSQPSJGXRNJ-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC=C([N+]([O-])=O)C=C1 | | CAS DataBase Reference | 100-11-8(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-(bromomethyl)-4-nitro-(100-11-8) | | EPA Substance Registry System | Benzene, 1-(bromomethyl)-4-nitro- (100-11-8) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | XS7967000 | | F | 10-19-21 | | Hazard Note | Irritant/Corrosive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049085 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B
STOT SE 3 |
| | 4-Nitrobenzyl bromide Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 4-Nitrobenzyl bromide is used in the synthesis of di and tri-substituted azoles. It is also used in the preparation of N6-Benzyladenosine-5-uronamides as selective A3 adenosine agonists. | | Definition | ChEBI: A C-nitro compound that consists of nitrobenzene bearing a bromomethyl substituent at the para-position. | | Purification Methods | Recrystallise the bromide four times from absolute EtOH, then twice from cyclohexane/hexane/*benzene (1:1:1), followed by sublimation at 0.1mm and final recrystallisation from the same solvent mixture. [Lichtin & Rao J Am Chem Soc 83 2417 1961.] It has also been crystallised from pet ether (b 80-100o, 10mL/g, charcoal). It slowly decomposes even when stored in a desiccator in the dark. IRRITANT. [Beilstein 5 IV 861.] |
| | 4-Nitrobenzyl bromide Preparation Products And Raw materials |
|