|
|
| | Penicillamine Impurity 1 Basic information |
| Product Name: | Penicillamine Impurity 1 | | Synonyms: | Penicillamine Impurity 1;D-Valine, 3,3'-trithiobis- (9CI);-Trithiobis-D-valine;Penicillamine Impurity 6;D-Valine, 3,3′-trithiobis-;Penicillamine Impurity 1 (trisulfide);3,3'-Trithiobis-D-valine | | CAS: | 22801-32-7 | | MF: | C10H20N2O4S3 | | MW: | 328.48 | | EINECS: | | | Product Categories: | | | Mol File: | 22801-32-7.mol |  |
| | Penicillamine Impurity 1 Chemical Properties |
| Melting point | 170 - 173°C | | Boiling point | 518.9±60.0 °C(Predicted) | | density | 1.409±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Water (Slightly, Sonicated) | | pka | 1.73±0.12(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C10H20N2O4S3/c1-9(2,5(11)7(13)14)17-19-18-10(3,4)6(12)8(15)16/h5-6H,11-12H2,1-4H3,(H,13,14)(H,15,16)/t5-,6-/m0/s1 | | InChIKey | YXNSHRAZIFTXCR-WDSKDSINSA-N | | SMILES | S(C(C)(C)[C@H](C(O)=O)N)SSC(C)(C)[C@H](C(O)=O)N |
| | Penicillamine Impurity 1 Usage And Synthesis |
| Uses | 3,3''-Trithiobis-D-valine is involved in various studies related tophotolysis and radiolysis of di- and trisulfides. It is a useful compound to gain insights regarding the strength of C-S bonds in the tertiary C-SH compounds and intermediates. |
| | Penicillamine Impurity 1 Preparation Products And Raw materials |
|