2,2-DIMETHYLTETRAHYDROFURAN manufacturers
|
| | 2,2-DIMETHYLTETRAHYDROFURAN Basic information |
| Product Name: | 2,2-DIMETHYLTETRAHYDROFURAN | | Synonyms: | Tetrahydrofuran, 2,2-dimethyl-;2,2-DIMETHYLTETRAHYDROFURAN;2,2-dimethyloxolane;2,2-Dimethyltetrahydrofurane;Furan, tetrahydro-2,2-dimethyl- | | CAS: | 1003-17-4 | | MF: | C6H12O | | MW: | 100.16 | | EINECS: | | | Product Categories: | | | Mol File: | 1003-17-4.mol |  |
| | 2,2-DIMETHYLTETRAHYDROFURAN Chemical Properties |
| Melting point | -114.46°C | | Boiling point | 92°C | | density | 0.8355 (estimate) | | refractive index | 1.4070 | | InChI | InChI=1S/C6H12O/c1-6(2)4-3-5-7-6/h3-5H2,1-2H3 | | InChIKey | ZPDIRKNRUWXYLJ-UHFFFAOYSA-N | | SMILES | O1CCCC1(C)C |
| Risk Statements | 11 | | Safety Statements | 7-33-60 | | RIDADR | 3271 | | HazardClass | 3 | | PackingGroup | II |
| Provider | Language |
|
ALFA
| English |
| | 2,2-DIMETHYLTETRAHYDROFURAN Usage And Synthesis |
| Chemical Properties | Colorless and transparent liquid with certain volatility and pungent odor, and high chemical stability | | Uses | 2,2-Dimethyltetrahydrofuran is a heterocyclic ether used in the synthesis of tetrahydrofuran and other tetrahydropyran derivatives. |
| | 2,2-DIMETHYLTETRAHYDROFURAN Preparation Products And Raw materials |
|