|
|
| | 5-Carboxythiophene-2-boronic acid Basic information |
| | 5-Carboxythiophene-2-boronic acid Chemical Properties |
| Melting point | 135 °C | | Boiling point | 467.6±55.0 °C(Predicted) | | density | 1.59±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | solid | | pka | 3.35±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1S/C5H5BO4S/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2,9-10H,(H,7,8) | | InChIKey | OQGIKNPOYTVNNF-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)SC(B(O)O)=CC=1 | | CAS DataBase Reference | 465515-31-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36/38 | | Safety Statements | 26-36/37/39-37/39 | | WGK Germany | WGK 3 | | Hazard Note | Irritant/Keep Cold | | HazardClass | IRRITANT | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 5-Carboxythiophene-2-boronic acid Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powder |
| | 5-Carboxythiophene-2-boronic acid Preparation Products And Raw materials |
|