|
|
| | 4-Bromo-2,6-difluoroiodobenzene Basic information |
| Product Name: | 4-Bromo-2,6-difluoroiodobenzene | | Synonyms: | 4-BROMO-2,6 DIFLUORO-1-IODOBENZENE;4-BROMO-2,6-DIFLUOROIODOBENZENE;2,6-DIFLUORO-4-BROMOIODOBENZENE;1-BROMO-3,5-DIFLUORO-4-IODOBENZENE;5-Bromo-1,3-difluoro-2-iodobenzene;Bromodifluoroiodobenzene;5-Bromo-1,3-difluoro-2-iodobenzene >;Benzene, 5-bromo-1,3-difluoro-2-iodo- | | CAS: | 160976-02-3 | | MF: | C6H2BrF2I | | MW: | 318.89 | | EINECS: | | | Product Categories: | | | Mol File: | 160976-02-3.mol |  |
| | 4-Bromo-2,6-difluoroiodobenzene Chemical Properties |
| Melting point | 40-41°C | | Boiling point | 236.1±35.0 °C(Predicted) | | density | 2.342±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | form | crystals | | color | White to light yellow | | InChI | InChI=1S/C6H2BrF2I/c7-3-1-4(8)6(10)5(9)2-3/h1-2H | | InChIKey | NLWAKVGODLJALJ-UHFFFAOYSA-N | | SMILES | C1(F)=CC(Br)=CC(F)=C1I | | CAS DataBase Reference | 160976-02-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | Hazard Note | Irritant | | HS Code | 2903998090 |
| | 4-Bromo-2,6-difluoroiodobenzene Usage And Synthesis |
| Chemical Properties | Off-white to light brown solid | | Uses | Due to its unique chemical structure, 4-Bromo-2,6-difluoroiodobenzene contains halogen atoms such as bromine, fluorine, and iodine, and can participate in a variety of chemical reactions, such as cross-coupling reactions, nucleophilic substitution reactions, rearrangement reactions, etc. |
| | 4-Bromo-2,6-difluoroiodobenzene Preparation Products And Raw materials |
|