| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
5-[(4-[1,1'-Biphenyl]-4-yl-1,6-dihydro-6-oxo-2-pyrimidinyl)thio]-N-hydroxypentanamide manufacturers
- MC1742
-
- $149.00
-
2026-07-16
- CAS:1776116-74-5
- Purity: 99.20%
- Supply Ability: 10g
|
| | 5-[(4-[1,1'-Biphenyl]-4-yl-1,6-dihydro-6-oxo-2-pyrimidinyl)thio]-N-hydroxypentanamide Basic information |
| Product Name: | 5-[(4-[1,1'-Biphenyl]-4-yl-1,6-dihydro-6-oxo-2-pyrimidinyl)thio]-N-hydroxypentanamide | | Synonyms: | 5-[(4-[1,1'-Biphenyl]-4-yl-1,6-dihydro-6-oxo-2-pyrimidinyl)thio]-N-hydroxypentanamide;MC 1742;Pentanamide, 5-[(4-[1,1'-biphenyl]-4-yl-1,6-dihydro-6-oxo-2-pyrimidinyl)thio]-N-hydroxy-;MC1742,MC-1742;5-((4-([1,1'-Biphenyl]-4-yl)-6-oxo-1,6-dihydropyrimidin-2-yl)thio)-N-hydroxypentanamide | | CAS: | 1776116-74-5 | | MF: | C21H21N3O3S | | MW: | 395.47 | | EINECS: | | | Product Categories: | | | Mol File: | 1776116-74-5.mol | ![5-[(4-[1,1'-Biphenyl]-4-yl-1,6-dihydro-6-oxo-2-pyrimidinyl)thio]-N-hydroxypentanamide Structure](CAS/20200331/GIF/1776116-74-5.gif) |
| | 5-[(4-[1,1'-Biphenyl]-4-yl-1,6-dihydro-6-oxo-2-pyrimidinyl)thio]-N-hydroxypentanamide Chemical Properties |
| density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 100 mM | | form | A solid | | pka | 7.51±0.50(Predicted) | | color | White to off-white | | InChI | 1S/C21H21N3O3S/c25-19(24-27)8-4-5-13-28-21-22-18(14-20(26)23-21)17-11-9-16(10-12-17)15-6-2-1-3-7-15/h1-3,6-7,9-12,14,27H,4-5,8,13H2,(H,24,25)(H,22,23,26) | | InChIKey | AOFVDNFTELWRHV-UHFFFAOYSA-N | | SMILES | S(CCCCC(=O)NO)c1[nH][c](cc(n1)c2ccc(cc2)c3ccccc3)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-[(4-[1,1'-Biphenyl]-4-yl-1,6-dihydro-6-oxo-2-pyrimidinyl)thio]-N-hydroxypentanamide Usage And Synthesis |
| Uses | MC 1742 is a novel histone deacetylase inhibitor, which has been shown to induce growth arrest, apoptosis and differentiation in sarcoma cancer stem cells. | | Biological Activity | MC1742 is a uracil-based hydroxyamide (UBHA) th at acts as a subtype-selective histone deacetylases (HDACs) inhibitor (IC50: class I HDAC1/2/3/8 = 100/110/20/610 nM, class IIB HDAC6/10 = 7/40 nM, class IV HDAC11 = 100 nM, class IIA HDAC4/5/7/9 >50 μM). MC1742 exerts greater antiproliferation potency than SAHA in sarcoma cancer stem cell (CSC) cultures (MC1742/SAHA IC50 in μM = 0.25/1/RD, 1.12/1.13//MG-63, 1.4/3.92/SK-ES-1 post 72-hr treatment) and effectively reactivates HIV from latency (EC50 = 350 nM; JL at 10.6 cells) by upregulating histone acetylation at the HIV promoter without activating T cells. | | IC 50 | HDAC1: 0.1 μM (IC50); HDAC2: 0.11 μM (IC50); HDAC3: 0.02 μM (IC50); HDAC6: 0.007 μM (IC50); HDAC8: 0.61 μM (IC50); HDAC10: 0.04 μM (IC50); HDAC11: 0.1 μM (IC50) | | storage | Store at -20°C |
| | 5-[(4-[1,1'-Biphenyl]-4-yl-1,6-dihydro-6-oxo-2-pyrimidinyl)thio]-N-hydroxypentanamide Preparation Products And Raw materials |
|