| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | JR-7054, Methyl 5-(2,4-dichlorophenyl)isoxazole-3-carboxylate, 97% Basic information |
| | JR-7054, Methyl 5-(2,4-dichlorophenyl)isoxazole-3-carboxylate, 97% Chemical Properties |
| Boiling point | 403.9±45.0 °C(Predicted) | | density | 1.413±0.06 g/cm3(Predicted) | | pka | -6.82±0.38(Predicted) | | form | solid | | InChI | 1S/C11H7Cl2NO3/c1-16-11(15)9-5-10(17-14-9)7-3-2-6(12)4-8(7)13/h2-5H,1H3 | | InChIKey | XTICVRDHMGWBHY-UHFFFAOYSA-N | | SMILES | COC(C1=NOC(C2=C(Cl)C=C(Cl)C=C2)=C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | JR-7054, Methyl 5-(2,4-dichlorophenyl)isoxazole-3-carboxylate, 97% Usage And Synthesis |
| | JR-7054, Methyl 5-(2,4-dichlorophenyl)isoxazole-3-carboxylate, 97% Preparation Products And Raw materials |
|