| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-Butanone-1,1,1,3,3-d5 Basic information |
| Product Name: | 2-Butanone-1,1,1,3,3-d5 | | Synonyms: | 2-BUTANONE (1,1,1,3,3-D5, 98%);2-Butanone-d5;Deuterated 2-butanone, MEK-1,1,1,3,3-D5;1,1,1,3,3-pentadeuteriobutan-2-one;2-BUTANONE-1,1,1,3,3-D5, 98 ATOM % D;2-Butaneone-1,1,1,3,3-D5;methyl-d3ethyl-1,1-d2ketone;[2H5]-2-Butanone | | CAS: | 24313-50-6 | | MF: | C4H8O | | MW: | 72.11 | | EINECS: | | | Product Categories: | | | Mol File: | 24313-50-6.mol |  |
| | 2-Butanone-1,1,1,3,3-d5 Chemical Properties |
| Melting point | −87 °C(lit.) | | Boiling point | 80 °C(lit.) | | density | 0.860 g/mL at 25 °C | | refractive index | n20/D 1.379(lit.) | | Fp | 26 °F | | Henry's Law Constant | 3.7×10-1 mol/(m3Pa) at 25℃, Hiatt (2013) | | InChI | 1S/C4H8O/c1-3-4(2)5/h3H2,1-2H3/i2D3,3D2 | | InChIKey | ZWEHNKRNPOVVGH-PDWRLMEDSA-N | | SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])C | | EPA Substance Registry System | 2-Butanone-1,1,1,3,3-d5 (24313-50-6) | | CAS Number Unlabeled | 78-93-3 |
| Hazard Codes | F,Xi | | Risk Statements | 11-36-66-67 | | Safety Statements | 9-16 | | RIDADR | UN 1193 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 2
STOT SE 3 |
| | 2-Butanone-1,1,1,3,3-d5 Usage And Synthesis |
| | 2-Butanone-1,1,1,3,3-d5 Preparation Products And Raw materials |
|