|
|
| | 1-benzhydrylazetidin-3-Ol Basic information |
| | 1-benzhydrylazetidin-3-Ol Chemical Properties |
| Melting point | 106 °C | | Boiling point | 353.8±42.0 °C(Predicted) | | density | 1.189±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.24±0.20(Predicted) | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C16H17NO/c18-15-11-17(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16,18H,11-12H2 | | InChIKey | MMAJXKGUZYDTHV-UHFFFAOYSA-N | | SMILES | N1(C(C2=CC=CC=C2)C2=CC=CC=C2)CC(O)C1 | | CAS DataBase Reference | 18621-17-5(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | UN3259 | | Hazard Note | Irritant | | HazardClass | 8 | | HS Code | 29339900 |
| | 1-benzhydrylazetidin-3-Ol Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 1-(Diphenylmethyl)-3-hydroxyazetidine is used to identify inhibitors of CYP 3A4. | | Synthesis | To a solution of 1-(diphenylmethylamino)-3-chloro-2-propanol (Intermediate 32, 276 g, 1 mol) in ethanol (2 L) was slowly added N,N-diisopropylethylamine (DIPEA, 129 g, 1 mol) at 0 °C. Subsequently, the reaction mixture was heated to 90 °C and refluxed overnight. Upon completion of the reaction, the solvent was removed by distillation under reduced pressure to afford the crude product 1-diphenylmethyl-3-hydroxyazetidine (179 g, 75% yield). The product can be purified by recrystallization from a solvent mixture of acetone and petroleum ether. | | References | [1] Patent: WO2013/14448, 2013, A1. Location in patent: Page/Page column 96
[2] Medicinal Chemistry Research, 2013, vol. 22, # 12, p. 5982 - 5989
[3] Patent: US2003/229226, 2003, A1. Location in patent: Page 21-22
[4] Synthesis (Germany), 2018, vol. 50, # 5, p. 1020 - 1026 |
| | 1-benzhydrylazetidin-3-Ol Preparation Products And Raw materials |
|