- peonidin
-
- $9.80 / 1KG
-
2020-02-11
- CAS:134-01-0
- Min. Order: 1g
- Purity: ＞98%
- Supply Ability: 20 tons
|
| | PEONIDIN CHLORIDE Basic information |
| Product Name: | PEONIDIN CHLORIDE | | Synonyms: | 2-(4-hydroxy-3-methoxyphenyl)-1-benzopyrylium-3,5,7-triol chloride;PEONIDIN CHLORIDE;3,4',5,7-TETRAHYDROXY-3'-METHOXYFLAVYLIUM CHLORIDE;3,5,7,4'-TETRAHYDROXY-3'-METHOXYFLAVYLIUM CHLORIDE;peonidin;3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-benzopyrylium chloride;PEONIDIN CHLORIDE SNAP-N-SHOOT 0.1mg/mL(P);PEONIDIN CHLORIDE(P) | | CAS: | 134-01-0 | | MF: | C16H13ClO6 | | MW: | 336.72 | | EINECS: | 205-125-6 | | Product Categories: | Flavonoids;Anthocyanins | | Mol File: | 134-01-0.mol |  |
| | PEONIDIN CHLORIDE Chemical Properties |
| storage temp. | −20°C | | solubility | Soluble in methan | | form | Beige to reddish-brown solid. | | color | Red-black | | Major Application | food and beverages | | Cosmetics Ingredients Functions | SKIN PROTECTING
HAIR CONDITIONING
SKIN CONDITIONING - MISCELLANEOUS | | InChI | 1S/C16H12O6.ClH/c1-21-15-4-8(2-3-11(15)18)16-13(20)7-10-12(19)5-9(17)6-14(10)22-16;/h2-7H,1H3,(H3-,17,18,19,20);1H | | InChIKey | OGBSHLKSHNAPEW-UHFFFAOYSA-N | | SMILES | [Cl-].COc1cc(ccc1O)-c2[o+]c3cc(O)cc(O)c3cc2O |
| WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids |
| | PEONIDIN CHLORIDE Usage And Synthesis |
| Chemical Properties | Soluble in organic solvents such as methanol, ethanol, and DMSO. | | Uses | Peonidin Chloride is a chemical dye for hair. | | Definition | ChEBI: Peonidin chloride is an anthocyanidin chloride that has peonidin as the cationic component. It has a role as a metabolite, an antineoplastic agent, an apoptosis inducer and an antioxidant. It contains a peonidin. | | Biological Activity | Anthocyanidin. Antioxidant. | | target | COX | ERK |
| | PEONIDIN CHLORIDE Preparation Products And Raw materials |
|