|
|
| | N-Methyl-3,3-diphenylpropylamine Basic information |
| Product Name: | N-Methyl-3,3-diphenylpropylamine | | Synonyms: | (3,3-diphenylpropyl)methylamine;N-METHYL-3,3-DIPHENYLPROPYLAMINE;3,3-Diphenyl-N-Methylpropylamine;Methyl(3,3-diphenylpropyl)amine;N-Methyl-3,3-diphenyl-1-propanamine;N-Methyl-γ-phenylbenzenepropan-1-amine;3,3-Diphenyl-N-diphenyl-N-methylpropylamine;N-Methyl-3,3-diphenylpropan-1-aMine | | CAS: | 28075-29-8 | | MF: | C16H19N | | MW: | 225.33 | | EINECS: | 248-821-5 | | Product Categories: | | | Mol File: | 28075-29-8.mol |  |
| | N-Methyl-3,3-diphenylpropylamine Chemical Properties |
| Boiling point | 178 °C(Press: 10 Torr) | | density | 0.988±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 10.48±0.10(Predicted) | | form | Oil | | color | Clear Colourless to Pale Yellow | | InChI | InChI=1S/C16H19N/c1-17-13-12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16-17H,12-13H2,1H3 | | InChIKey | AKEGHAUFMKCWGX-UHFFFAOYSA-N | | SMILES | N(CCC(C1=CC=CC=C1)C1=CC=CC=C1)C | | CAS DataBase Reference | 28075-29-8(CAS DataBase Reference) |
| | N-Methyl-3,3-diphenylpropylamine Usage And Synthesis |
| Uses | N-Methyl-3,3-diphenylpropylamine is an intermediate for the synthesis of SNRI-NMDA antagonist and neuroprotectants. |
| | N-Methyl-3,3-diphenylpropylamine Preparation Products And Raw materials |
|