(R)-2-HYDROXYBUTYRIC ACID manufacturers
|
| | (R)-2-HYDROXYBUTYRIC ACID Basic information |
| | (R)-2-HYDROXYBUTYRIC ACID Chemical Properties |
| Melting point | 50-54 °C | | Boiling point | 238.3±13.0 °C(Predicted) | | density | 1.195±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 3.83±0.10(Predicted) | | color | White to Off-White | | BRN | 1720939 | | InChI | InChI=1S/C4H8O3/c1-2-3(5)4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m1/s1 | | InChIKey | AFENDNXGAFYKQO-GSVOUGTGSA-N | | SMILES | C(O)(=O)[C@H](O)CC |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 2918199890 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | (R)-2-HYDROXYBUTYRIC ACID Usage And Synthesis |
| Uses | (R)-2-Hydroxybutanoic Acid can be used as remedy for a hangover. | | Definition | ChEBI: An optically active form of 2-hydroxybutyric acid having (R)-configuration. |
| | (R)-2-HYDROXYBUTYRIC ACID Preparation Products And Raw materials |
|