|
|
| | 5-(2-Benzothiazolyl)-3-ethyl-2-(-(methy Basic information |
| Product Name: | 5-(2-Benzothiazolyl)-3-ethyl-2-(-(methy | | Synonyms: | Akt Inhibitor IV - CAS 681281-88-9 - Calbiochem;(E)-5-(benzo[d]thiazol-2-yl)-3-ethyl-2-(2-(methyl(phenyl)amino)vinyl)-1-phenyl-1H-benzo[d]imidazol-3-ium iodide;6-benzothiazol-2-yl-1-ethyl-2-[2-(methyl-phenyl-amino)-vinyl]-3-phenyl-3H-benzoimidazol-1-ium iodide;5-(Benzo[d]thiazol-2-yl)-3-ethyl-2-(2-(methyl(phenyl)amino)vinyl)-1-phenyl-1H-benzo[d]imidazol-3-ium iodide;6-(2-Benzothiazolyl)-1-ethyl-2-[2-(methylphenylamino)ethenyl]-3-phenyl-1H-benzimidazolium iodide;5-(2-Benzothiazolyl)-3-ethyl-2-(-(methy | | CAS: | 681281-88-9 | | MF: | C31H27N4S.I | | MW: | 614.548 | | EINECS: | | | Product Categories: | | | Mol File: | 681281-88-9.mol |  |
| | 5-(2-Benzothiazolyl)-3-ethyl-2-(-(methy Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: ≥10 mg/mL | | form | solid | | color | orange | | InChIKey | NAYRELMNTQSBIN-UHFFFAOYSA-M | | SMILES | [I-].CC[n+]1c(\C=C\N(C)c2ccccc2)n(-c3ccccc3)c4ccc(cc14)-c5nc6ccccc6s5 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 5-(2-Benzothiazolyl)-3-ethyl-2-(-(methy Usage And Synthesis |
| Uses | Akt Inhibitor IV is an Inhibitor of Akt protein kinase | | Biological Activity | akt inhibitor iv is an inhibitor of akt activation that inhibits akt-mediated nuclear export of forkhead box class o transcription factor 1a (foxo1a; ic50 = 625 nm) and reduces phosphorylation of akt at ser473 and thr308 in a dose-dependent manner. akt inhibitor iv inhibits replication of parainfluenza virus 5 (piv5) in hela cells (ic50 = 520 nm). it also reduces the growth of cancer cells (ic50 = 0.3 μm for both jurkat and hela cells) via a reduction in mitochondrial polarization and increased production of reactive oxygen species (ros). |
| | 5-(2-Benzothiazolyl)-3-ethyl-2-(-(methy Preparation Products And Raw materials |
|