| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:5-(3,4-Dichloro-phenyl)-furan-2-carboxylic acid CAS:54023-01-7 Package:1g
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:5-(3,4-Dichlorophenyl)-2-furoic acid CAS:54023-01-7 Purity:97% Package:1G,5G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:5-(3,4-Dichlorophenyl)-2-furoic acid CAS:54023-01-7 Purity:95+% Remarks:B46139
|
|
| | 5-(3,4-Dichlorophenyl)-2-furoic acid Basic information |
| | 5-(3,4-Dichlorophenyl)-2-furoic acid Chemical Properties |
| Melting point | 236-240 °C (lit.) | | Boiling point | 425.0±45.0 °C(Predicted) | | density | 1.477±0.06 g/cm3(Predicted) | | pka | 2.83±0.10(Predicted) | | form | solid | | InChI | 1S/C11H6Cl2O3/c12-7-2-1-6(5-8(7)13)9-3-4-10(16-9)11(14)15/h1-5H,(H,14,15) | | InChIKey | GNXLBNMHCYYSPU-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(o1)-c2ccc(Cl)c(Cl)c2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 5-(3,4-Dichlorophenyl)-2-furoic acid Usage And Synthesis |
| Uses | 5-(3,4-Dichlorophenyl)-2-furoic acid is a reactant in the preparation of dantrolene (D185000) which has a potential to treat vascular dysfunction. |
| | 5-(3,4-Dichlorophenyl)-2-furoic acid Preparation Products And Raw materials |
|